![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| AylerMashupsZip.7z | 2024-12-22 21:55 | 174K | |
| Deck the Hall - Omeg..> | 2016-12-31 22:25 | 71K | |
| Zion hill - First No..> | 2016-12-31 22:27 | 32K | |
| Omega is the alpha v..> | 2016-12-31 22:24 | 24K | |
| O Tannenbaum - Ghost..> | 2016-12-31 22:23 | 23K | |
| O Tannenbaum - Ghost..> | 2016-12-31 22:25 | 23K | |
| Joy to the World - B..> | 2016-12-31 22:22 | 23K | |
| Spirits - Angels Fro..> | 2016-12-31 22:26 | 19K | |
| Spirits - Angels Fro..> | 2016-12-31 22:26 | 19K | |
| Vibrations - Good Ki..> | 2016-12-31 22:27 | 16K | |